![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| HVAC system (auto ac) diag/ | 2023-05-15 10:27 | - | |
| HVAC system (heater vent and ac)/ | 2023-05-15 10:27 | - | |
| airbag system/ | 2023-05-15 10:27 | - | |
| airbag system diag/ | 2023-05-15 10:27 | - | |
| body structure/ | 2023-05-15 10:27 | - | |
| communication system/ | 2023-05-15 10:27 | - | |
| cruise control system/ | 2023-05-15 10:27 | - | |
| cruise control system diag/ | 2023-05-15 10:27 | - | |
| entertainment/ | 2023-05-15 10:27 | - | |
| exterior body panels/ | 2023-05-15 10:27 | - | |
| exterior interior trim/ | 2023-05-15 10:27 | - | |
| glass windows mirrors/ | 2023-05-15 10:27 | - | |
| immobilizer/ | 2023-05-15 10:27 | - | |
| instrumentation driver info/ | 2023-05-15 10:27 | - | |
| lighting system/ | 2023-05-15 10:27 | - | |
| occupant detection system diag/ | 2023-05-15 10:27 | - | |
| seat belt system/ | 2023-05-15 10:27 | - | |
| seats/ | 2023-05-15 10:27 | - | |
| security and locks/ | 2023-05-15 10:27 | - | |
| sunroof/ | 2023-05-15 10:27 | - | |
| wiper and washer system/ | 2023-05-15 10:27 | - | |